C10H10N6S — CID 47136338
N-(2-thiophen-2-ylethyl)tetrazolo[1,5-b]pyridazin-6-amine (PubChem CID 47136338) has the molecular formula C10H10N6S and a molecular weight of 246.30 g/mol. Its IUPAC name is N-(2-thiophen-2-ylethyl)tetrazolo[1,5-b]pyridazin-6-amine.
| Compound Name | N-(2-thiophen-2-ylethyl)tetrazolo[1,5-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 47136338 |
| Molecular Formula | C10H10N6S |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | N-(2-thiophen-2-ylethyl)tetrazolo[1,5-b]pyridazin-6-amine |
| SMILES | c1csc(CCNc2ccc3nnnn3n2)c1 |
| InChI | InChI=1S/C10H10N6S/c1-2-8(17-7-1)5-6-11-9-3-4-10-12-14-15-16(10)13-9/h1-4,7H,5-6H2,(H,11,13) |
| InChIKey | UJJIXYIJJBEOMZ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 68.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |