C11H14N6 — CID 103844181
N-[2-(cyclopenten-1-yl)ethyl]tetrazolo[1,5-b]pyridazin-6-amine (PubChem CID 103844181) has the molecular formula C11H14N6 and a molecular weight of 230.27 g/mol. Its IUPAC name is N-[2-(cyclopenten-1-yl)ethyl]tetrazolo[1,5-b]pyridazin-6-amine.
| Compound Name | N-[2-(cyclopenten-1-yl)ethyl]tetrazolo[1,5-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 103844181 |
| Molecular Formula | C11H14N6 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | N-[2-(cyclopenten-1-yl)ethyl]tetrazolo[1,5-b]pyridazin-6-amine |
| SMILES | C1=C(CCNc2ccc3nnnn3n2)CCC1 |
| InChI | InChI=1S/C11H14N6/c1-2-4-9(3-1)7-8-12-10-5-6-11-13-15-16-17(11)14-10/h3,5-6H,1-2,4,7-8H2,(H,12,14) |
| InChIKey | FSJBSWUMZTYNJY-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 68.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|