C10H16N6 — CID 52547064
N-hexyltetrazolo[1,5-b]pyridazin-6-amine (PubChem CID 52547064) has the molecular formula C10H16N6 and a molecular weight of 220.28 g/mol. Its IUPAC name is N-hexyltetrazolo[1,5-b]pyridazin-6-amine.
| Compound Name | N-hexyltetrazolo[1,5-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 52547064 |
| Molecular Formula | C10H16N6 |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | N-hexyltetrazolo[1,5-b]pyridazin-6-amine |
| SMILES | CCCCCCNc1ccc2nnnn2n1 |
| InChI | InChI=1S/C10H16N6/c1-2-3-4-5-8-11-9-6-7-10-12-14-15-16(10)13-9/h6-7H,2-5,8H2,1H3,(H,11,13) |
| InChIKey | DCAJQSPWJYCKJC-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 68.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|