C14H17N7 — CID 17470486
N'-methyl-N'-phenyl-N-(tetrazolo[1,5-b]pyridazin-6-yl)propane-1,3-diamine (PubChem CID 17470486) has the molecular formula C14H17N7 and a molecular weight of 283.34 g/mol. Its IUPAC name is N'-methyl-N'-phenyl-N-(tetrazolo[1,5-b]pyridazin-6-yl)propane-1,3-diamine.
| Compound Name | N'-methyl-N'-phenyl-N-(tetrazolo[1,5-b]pyridazin-6-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 17470486 |
| Molecular Formula | C14H17N7 |
| Molecular Weight | 283.34 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | N'-methyl-N'-phenyl-N-(tetrazolo[1,5-b]pyridazin-6-yl)propane-1,3-diamine |
| SMILES | CN(CCCNc1ccc2nnnn2n1)c1ccccc1 |
| InChI | InChI=1S/C14H17N7/c1-20(12-6-3-2-4-7-12)11-5-10-15-13-8-9-14-16-18-19-21(14)17-13/h2-4,6-9H,5,10-11H2,1H3,(H,15,17) |
| InChIKey | YNPZVJUJOCZZQM-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 71.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.34 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|