C15H17N9 — CID 125432939
N-[5-([1,2,4]triazolo[4,3-a]pyridin-3-yl)pentyl]tetrazolo[1,5-b]pyridazin-6-amine (PubChem CID 125432939) has the molecular formula C15H17N9 and a molecular weight of 323.36 g/mol. Its IUPAC name is N-[5-([1,2,4]triazolo[4,3-a]pyridin-3-yl)pentyl]tetrazolo[1,5-b]pyridazin-6-amine.
| Compound Name | N-[5-([1,2,4]triazolo[4,3-a]pyridin-3-yl)pentyl]tetrazolo[1,5-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 125432939 |
| Molecular Formula | C15H17N9 |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | N-[5-([1,2,4]triazolo[4,3-a]pyridin-3-yl)pentyl]tetrazolo[1,5-b]pyridazin-6-amine |
| SMILES | c1ccn2c(CCCCCNc3ccc4nnnn4n3)nnc2c1 |
| InChI | InChI=1S/C15H17N9/c1(2-6-13-17-18-14-7-3-5-11-23(13)14)4-10-16-12-8-9-15-19-21-22-24(15)20-12/h3,5,7-9,11H,1-2,4,6,10H2,(H,16,20) |
| InChIKey | YVJDJKBJGKWSMM-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 98.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|