C12H20N6 — CID 113337448
N-octyltetrazolo[1,5-b]pyridazin-6-amine (PubChem CID 113337448) has the molecular formula C12H20N6 and a molecular weight of 248.33 g/mol. Its IUPAC name is N-octyltetrazolo[1,5-b]pyridazin-6-amine.
| Compound Name | N-octyltetrazolo[1,5-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 113337448 |
| Molecular Formula | C12H20N6 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.17 |
| IUPAC Name | N-octyltetrazolo[1,5-b]pyridazin-6-amine |
| SMILES | CCCCCCCCNc1ccc2nnnn2n1 |
| InChI | InChI=1S/C12H20N6/c1-2-3-4-5-6-7-10-13-11-8-9-12-14-16-17-18(12)15-11/h8-9H,2-7,10H2,1H3,(H,13,15) |
| InChIKey | RQXJKSGFJLTOEZ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 68.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|