C13H20N6O — CID 94032457
N-[2-[(1R,2R)-2-methylcyclohexyl]oxyethyl]tetrazolo[1,5-b]pyridazin-6-amine (PubChem CID 94032457) has the molecular formula C13H20N6O and a molecular weight of 276.34 g/mol. Its IUPAC name is N-[2-[(1R,2R)-2-methylcyclohexyl]oxyethyl]tetrazolo[1,5-b]pyridazin-6-amine.
| Compound Name | N-[2-[(1R,2R)-2-methylcyclohexyl]oxyethyl]tetrazolo[1,5-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 94032457 |
| Molecular Formula | C13H20N6O |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | N-[2-[(1R,2R)-2-methylcyclohexyl]oxyethyl]tetrazolo[1,5-b]pyridazin-6-amine |
| SMILES | C[C@@H]1CCCC[C@H]1OCCNc1ccc2nnnn2n1 |
| InChI | InChI=1S/C13H20N6O/c1-10-4-2-3-5-11(10)20-9-8-14-12-6-7-13-15-17-18-19(13)16-12/h6-7,10-11H,2-5,8-9H2,1H3,(H,14,16)/t10-,11-/m1/s1 |
| InChIKey | RUZCQUZEOSCGOL-GHMZBOCLSA-N |
| XLogP | 1.53 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|