C10H9N7 — CID 112723167
N-(pyridin-4-ylmethyl)tetrazolo[1,5-b]pyridazin-6-amine (PubChem CID 112723167) has the molecular formula C10H9N7 and a molecular weight of 227.23 g/mol. Its IUPAC name is N-(pyridin-4-ylmethyl)tetrazolo[1,5-b]pyridazin-6-amine.
| Compound Name | N-(pyridin-4-ylmethyl)tetrazolo[1,5-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 112723167 |
| Molecular Formula | C10H9N7 |
| Molecular Weight | 227.23 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | N-(pyridin-4-ylmethyl)tetrazolo[1,5-b]pyridazin-6-amine |
| SMILES | c1cc(CNc2ccc3nnnn3n2)ccn1 |
| InChI | InChI=1S/C10H9N7/c1-2-10-13-15-16-17(10)14-9(1)12-7-8-3-5-11-6-4-8/h1-6H,7H2,(H,12,14) |
| InChIKey | RASOENNXPCYQQP-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 80.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.23 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |