C13H7ClIN3 — CID 155728996
4-chloro-6-(3-iodophenyl)pyrido[3,2-d]pyrimidine (PubChem CID 155728996) has the molecular formula C13H7ClIN3 and a molecular weight of 367.58 g/mol. Its IUPAC name is 4-chloro-6-(3-iodophenyl)pyrido[3,2-d]pyrimidine.
| Compound Name | 4-chloro-6-(3-iodophenyl)pyrido[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 155728996 |
| Molecular Formula | C13H7ClIN3 |
| Molecular Weight | 367.58 g/mol |
| Exact Mass | 366.94 |
| IUPAC Name | 4-chloro-6-(3-iodophenyl)pyrido[3,2-d]pyrimidine |
| SMILES | Clc1ncnc2ccc(-c3cccc(I)c3)nc12 |
| InChI | InChI=1S/C13H7ClIN3/c14-13-12-11(16-7-17-13)5-4-10(18-12)8-2-1-3-9(15)6-8/h1-7H |
| InChIKey | MBKDAIICGJZNQQ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.58 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|