C14H8ClIN2 — CID 155340444
8-chloro-2-(3-iodophenyl)-1,7-naphthyridine (PubChem CID 155340444) has the molecular formula C14H8ClIN2 and a molecular weight of 366.59 g/mol. Its IUPAC name is 8-chloro-2-(3-iodophenyl)-1,7-naphthyridine.
| Compound Name | 8-chloro-2-(3-iodophenyl)-1,7-naphthyridine |
|---|---|
| PubChem CID | 155340444 |
| Molecular Formula | C14H8ClIN2 |
| Molecular Weight | 366.59 g/mol |
| Exact Mass | 365.94 |
| IUPAC Name | 8-chloro-2-(3-iodophenyl)-1,7-naphthyridine |
| SMILES | Clc1nccc2ccc(-c3cccc(I)c3)nc12 |
| InChI | InChI=1S/C14H8ClIN2/c15-14-13-9(6-7-17-14)4-5-12(18-13)10-2-1-3-11(16)8-10/h1-8H |
| InChIKey | CJIDUAUYTVBGHA-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.59 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|