C14H7IN4 — CID 155341345
6-(3-iodophenyl)pyrido[3,2-d]pyrimidine-4-carbonitrile (PubChem CID 155341345) has the molecular formula C14H7IN4 and a molecular weight of 358.14 g/mol. Its IUPAC name is 6-(3-iodophenyl)pyrido[3,2-d]pyrimidine-4-carbonitrile.
| Compound Name | 6-(3-iodophenyl)pyrido[3,2-d]pyrimidine-4-carbonitrile |
|---|---|
| PubChem CID | 155341345 |
| Molecular Formula | C14H7IN4 |
| Molecular Weight | 358.14 g/mol |
| Exact Mass | 357.97 |
| IUPAC Name | 6-(3-iodophenyl)pyrido[3,2-d]pyrimidine-4-carbonitrile |
| SMILES | N#Cc1ncnc2ccc(-c3cccc(I)c3)nc12 |
| InChI | InChI=1S/C14H7IN4/c15-10-3-1-2-9(6-10)11-4-5-12-14(19-11)13(7-16)18-8-17-12/h1-6,8H |
| InChIKey | IDGWUMCKXLGOGM-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.14 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|