C13H10N4O — CID 155340602
6-(3-aminophenyl)-3H-pyrido[3,2-d]pyrimidin-4-one (PubChem CID 155340602) has the molecular formula C13H10N4O and a molecular weight of 238.25 g/mol. Its IUPAC name is 6-(3-aminophenyl)-3H-pyrido[3,2-d]pyrimidin-4-one.
| Compound Name | 6-(3-aminophenyl)-3H-pyrido[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 155340602 |
| Molecular Formula | C13H10N4O |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 6-(3-aminophenyl)-3H-pyrido[3,2-d]pyrimidin-4-one |
| SMILES | Nc1cccc(-c2ccc3nc[nH]c(=O)c3n2)c1 |
| InChI | InChI=1S/C13H10N4O/c14-9-3-1-2-8(6-9)10-4-5-11-12(17-10)13(18)16-7-15-11/h1-7H,14H2,(H,15,16,18) |
| InChIKey | FRNJMDNUDLHFID-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|