C7H4FN3O — CID 135427088
6-fluoro-3H-pyrido[3,2-d]pyrimidin-4-one (PubChem CID 135427088) has the molecular formula C7H4FN3O and a molecular weight of 165.13 g/mol. Its IUPAC name is 6-fluoro-3H-pyrido[3,2-d]pyrimidin-4-one.
| Compound Name | 6-fluoro-3H-pyrido[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135427088 |
| Molecular Formula | C7H4FN3O |
| Molecular Weight | 165.13 g/mol |
| Exact Mass | 165.03 |
| IUPAC Name | 6-fluoro-3H-pyrido[3,2-d]pyrimidin-4-one |
| SMILES | O=c1[nH]cnc2ccc(F)nc12 |
| InChI | InChI=1S/C7H4FN3O/c8-5-2-1-4-6(11-5)7(12)10-3-9-4/h1-3H,(H,9,10,12) |
| InChIKey | PKDOHUMRKCAPRY-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.13 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|