About methane;3H-quinazolin-4-one
methane;3H-quinazolin-4-one (PubChem CID 143348425) has the molecular formula C9H10N2O
and a molecular weight of 162.19 g/mol. Its IUPAC name is methane;3H-quinazolin-4-one.
Molecular Properties
| Compound Name | methane;3H-quinazolin-4-one |
| PubChem CID | 143348425 |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | methane;3H-quinazolin-4-one |
| SMILES | C.O=c1[nH]cnc2ccccc12 |
| InChI | InChI=1S/C8H6N2O.CH4/c11-8-6-3-1-2-4-7(6)9-5-10-8;/h1-5H,(H,9,10,11);1H4 |
| InChIKey | PWRQCEQAENEFPE-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methane;3H-quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;3H-quinazolin-4-one?
The IUPAC name of methane;3H-quinazolin-4-one (CID 143348425) is methane;3H-quinazolin-4-one.
What is the SMILES notation for methane;3H-quinazolin-4-one?
The canonical SMILES for methane;3H-quinazolin-4-one is C.O=c1[nH]cnc2ccccc12.
What is the InChIKey of methane;3H-quinazolin-4-one?
The InChIKey is PWRQCEQAENEFPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O.CH4/c11-8-6-3-1-2-4-7(6)9-5-10-8;/h1-5H,(H,9,10,11);1H4.
What are the key properties of methane;3H-quinazolin-4-one?
methane;3H-quinazolin-4-one has a molecular weight of 162.19 g/mol, XLogP of 1.56, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methane;3H-quinazolin-4-one is sourced from PubChem (CID 143348425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).