C11H7N3O — CID 135802600
3H-pyrimido[5,4-c]quinolin-4-one (PubChem CID 135802600) has the molecular formula C11H7N3O and a molecular weight of 197.20 g/mol. Its IUPAC name is 3H-pyrimido[5,4-c]quinolin-4-one.
| Compound Name | 3H-pyrimido[5,4-c]quinolin-4-one |
|---|---|
| PubChem CID | 135802600 |
| Molecular Formula | C11H7N3O |
| Molecular Weight | 197.20 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | 3H-pyrimido[5,4-c]quinolin-4-one |
| SMILES | O=c1[nH]cnc2c1cnc1ccccc12 |
| InChI | InChI=1S/C11H7N3O/c15-11-8-5-12-9-4-2-1-3-7(9)10(8)13-6-14-11/h1-6H,(H,13,14,15) |
| InChIKey | XRHGKTQGQIAMBO-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.20 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|