About 4-chloroquinazoline;phosphoryl trichloride;3H-quinazolin-4-one
4-chloroquinazoline;phosphoryl trichloride;3H-quinazolin-4-one (PubChem CID 158793020) has the molecular formula C16H11Cl4N4O2P
and a molecular weight of 464.08 g/mol. Its IUPAC name is 4-chloroquinazoline;phosphoryl trichloride;3H-quinazolin-4-one.
Molecular Properties
| Compound Name | 4-chloroquinazoline;phosphoryl trichloride;3H-quinazolin-4-one |
| PubChem CID | 158793020 |
| Molecular Formula | C16H11Cl4N4O2P |
| Molecular Weight | 464.08 g/mol |
| Exact Mass | 461.94 |
| IUPAC Name | 4-chloroquinazoline;phosphoryl trichloride;3H-quinazolin-4-one |
| SMILES | Clc1ncnc2ccccc12.O=P(Cl)(Cl)Cl.O=c1[nH]cnc2ccccc12 |
| InChI | InChI=1S/C8H5ClN2.C8H6N2O.Cl3OP/c9-8-6-3-1-2-4-7(6)10-5-11-8;11-8-6-3-1-2-4-7(6)9-5-10-8;1-5(2,3)4/h1-5H;1-5H,(H,9,10,11); |
| InChIKey | ISMZNXPDIBKIAN-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 464.08 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-chloroquinazoline;phosphoryl trichloride;3H-quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloroquinazoline;phosphoryl trichloride;3H-quinazolin-4-one?
The IUPAC name of 4-chloroquinazoline;phosphoryl trichloride;3H-quinazolin-4-one (CID 158793020) is 4-chloroquinazoline;phosphoryl trichloride;3H-quinazolin-4-one.
What is the SMILES notation for 4-chloroquinazoline;phosphoryl trichloride;3H-quinazolin-4-one?
The canonical SMILES for 4-chloroquinazoline;phosphoryl trichloride;3H-quinazolin-4-one is Clc1ncnc2ccccc12.O=P(Cl)(Cl)Cl.O=c1[nH]cnc2ccccc12.
What is the InChIKey of 4-chloroquinazoline;phosphoryl trichloride;3H-quinazolin-4-one?
The InChIKey is ISMZNXPDIBKIAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5ClN2.C8H6N2O.Cl3OP/c9-8-6-3-1-2-4-7(6)10-5-11-8;11-8-6-3-1-2-4-7(6)9-5-10-8;1-5(2,3)4/h1-5H;1-5H,(H,9,10,11);.
What are the key properties of 4-chloroquinazoline;phosphoryl trichloride;3H-quinazolin-4-one?
4-chloroquinazoline;phosphoryl trichloride;3H-quinazolin-4-one has a molecular weight of 464.08 g/mol, XLogP of 6.02, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloroquinazoline;phosphoryl trichloride;3H-quinazolin-4-one is sourced from PubChem (CID 158793020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).