C29H26ClIN6O2 — CID 159103363
4-chloro-5,6-dimethylquinazoline;5,6-dimethyl-3H-quinazolin-4-one;6-iodo-5-methyl-3H-quinazolin-4-one (PubChem CID 159103363) has the molecular formula C29H26ClIN6O2 and a molecular weight of 652.92 g/mol. Its IUPAC name is 4-chloro-5,6-dimethylquinazoline;5,6-dimethyl-3H-quinazolin-4-one;6-iodo-5-methyl-3H-quinazolin-4-one.
| Compound Name | 4-chloro-5,6-dimethylquinazoline;5,6-dimethyl-3H-quinazolin-4-one;6-iodo-5-methyl-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 159103363 |
| Molecular Formula | C29H26ClIN6O2 |
| Molecular Weight | 652.92 g/mol |
| Exact Mass | 652.09 |
| IUPAC Name | 4-chloro-5,6-dimethylquinazoline;5,6-dimethyl-3H-quinazolin-4-one;6-iodo-5-methyl-3H-quinazolin-4-one |
| SMILES | Cc1c(I)ccc2nc[nH]c(=O)c12.Cc1ccc2nc[nH]c(=O)c2c1C.Cc1ccc2ncnc(Cl)c2c1C |
| InChI | InChI=1S/C10H9ClN2.C10H10N2O.C9H7IN2O/c1-6-3-4-8-9(7(6)2)10(11)13-5-12-8;1-6-3-4-8-9(7(6)2)10(13)12-5-11-8;1-5-6(10)2-3-7-8(5)9(13)12-4-11-7/h3-5H,1-2H3;3-5H,1-2H3,(H,11,12,13);2-4H,1H3,(H,11,12,13) |
| InChIKey | KDOKAHROOBSPNR-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.92 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|