C18H18ClFN4OS — CID 155747904
6-[2-chloro-6-fluoro-3-(propylsulfanylamino)anilino]-5-methyl-3H-quinazolin-4-one (PubChem CID 155747904) has the molecular formula C18H18ClFN4OS and a molecular weight of 392.89 g/mol. Its IUPAC name is 6-[2-chloro-6-fluoro-3-(propylsulfanylamino)anilino]-5-methyl-3H-quinazolin-4-one.
| Compound Name | 6-[2-chloro-6-fluoro-3-(propylsulfanylamino)anilino]-5-methyl-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 155747904 |
| Molecular Formula | C18H18ClFN4OS |
| Molecular Weight | 392.89 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | 6-[2-chloro-6-fluoro-3-(propylsulfanylamino)anilino]-5-methyl-3H-quinazolin-4-one |
| SMILES | CCCSNc1ccc(F)c(Nc2ccc3nc[nH]c(=O)c3c2C)c1Cl |
| InChI | InChI=1S/C18H18ClFN4OS/c1-3-8-26-24-14-5-4-11(20)17(16(14)19)23-12-6-7-13-15(10(12)2)18(25)22-9-21-13/h4-7,9,23-24H,3,8H2,1-2H3,(H,21,22,25) |
| InChIKey | ITDIGGVKWUPKLU-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.89 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|