C20H22ClFN4OS — CID 155747889
6-[2-chloro-6-fluoro-3-(propylsulfanylamino)anilino]-3-ethyl-5-methylquinazolin-4-one (PubChem CID 155747889) has the molecular formula C20H22ClFN4OS and a molecular weight of 420.94 g/mol. Its IUPAC name is 6-[2-chloro-6-fluoro-3-(propylsulfanylamino)anilino]-3-ethyl-5-methylquinazolin-4-one.
| Compound Name | 6-[2-chloro-6-fluoro-3-(propylsulfanylamino)anilino]-3-ethyl-5-methylquinazolin-4-one |
|---|---|
| PubChem CID | 155747889 |
| Molecular Formula | C20H22ClFN4OS |
| Molecular Weight | 420.94 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | 6-[2-chloro-6-fluoro-3-(propylsulfanylamino)anilino]-3-ethyl-5-methylquinazolin-4-one |
| SMILES | CCCSNc1ccc(F)c(Nc2ccc3ncn(CC)c(=O)c3c2C)c1Cl |
| InChI | InChI=1S/C20H22ClFN4OS/c1-4-10-28-25-16-7-6-13(22)19(18(16)21)24-14-8-9-15-17(12(14)3)20(27)26(5-2)11-23-15/h6-9,11,24-25H,4-5,10H2,1-3H3 |
| InChIKey | NVBUAIORDLGZKI-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.94 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|