C16H14F2N4O — CID 165149864
6-(3-amino-2,6-difluoroanilino)-3,5-dimethylquinazolin-4-one (PubChem CID 165149864) has the molecular formula C16H14F2N4O and a molecular weight of 316.31 g/mol. Its IUPAC name is 6-(3-amino-2,6-difluoroanilino)-3,5-dimethylquinazolin-4-one.
| Compound Name | 6-(3-amino-2,6-difluoroanilino)-3,5-dimethylquinazolin-4-one |
|---|---|
| PubChem CID | 165149864 |
| Molecular Formula | C16H14F2N4O |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 6-(3-amino-2,6-difluoroanilino)-3,5-dimethylquinazolin-4-one |
| SMILES | Cc1c(Nc2c(F)ccc(N)c2F)ccc2ncn(C)c(=O)c12 |
| InChI | InChI=1S/C16H14F2N4O/c1-8-11(21-15-9(17)3-4-10(19)14(15)18)5-6-12-13(8)16(23)22(2)7-20-12/h3-7,21H,19H2,1-2H3 |
| InChIKey | JDLCNXXPEKNLOD-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|