C15H10ClF3N4O — CID 165149922
6-(3-amino-2-chloro-5,6-difluoroanilino)-5-fluoro-3-methylquinazolin-4-one (PubChem CID 165149922) has the molecular formula C15H10ClF3N4O and a molecular weight of 354.72 g/mol. Its IUPAC name is 6-(3-amino-2-chloro-5,6-difluoroanilino)-5-fluoro-3-methylquinazolin-4-one.
| Compound Name | 6-(3-amino-2-chloro-5,6-difluoroanilino)-5-fluoro-3-methylquinazolin-4-one |
|---|---|
| PubChem CID | 165149922 |
| Molecular Formula | C15H10ClF3N4O |
| Molecular Weight | 354.72 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | 6-(3-amino-2-chloro-5,6-difluoroanilino)-5-fluoro-3-methylquinazolin-4-one |
| SMILES | Cn1cnc2ccc(Nc3c(F)c(F)cc(N)c3Cl)c(F)c2c1=O |
| InChI | InChI=1S/C15H10ClF3N4O/c1-23-5-21-8-2-3-9(13(19)10(8)15(23)24)22-14-11(16)7(20)4-6(17)12(14)18/h2-5,22H,20H2,1H3 |
| InChIKey | LYPXCQIJZZXKFW-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.72 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|