C19H21ClFN5OS — CID 155747846
6-[2-chloro-3-[[ethyl(methyl)amino]sulfanylamino]-6-fluoroanilino]-3,5-dimethylquinazolin-4-one (PubChem CID 155747846) has the molecular formula C19H21ClFN5OS and a molecular weight of 421.93 g/mol. Its IUPAC name is 6-[2-chloro-3-[[ethyl(methyl)amino]sulfanylamino]-6-fluoroanilino]-3,5-dimethylquinazolin-4-one.
| Compound Name | 6-[2-chloro-3-[[ethyl(methyl)amino]sulfanylamino]-6-fluoroanilino]-3,5-dimethylquinazolin-4-one |
|---|---|
| PubChem CID | 155747846 |
| Molecular Formula | C19H21ClFN5OS |
| Molecular Weight | 421.93 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | 6-[2-chloro-3-[[ethyl(methyl)amino]sulfanylamino]-6-fluoroanilino]-3,5-dimethylquinazolin-4-one |
| SMILES | CCN(C)SNc1ccc(F)c(Nc2ccc3ncn(C)c(=O)c3c2C)c1Cl |
| InChI | InChI=1S/C19H21ClFN5OS/c1-5-26(4)28-24-15-7-6-12(21)18(17(15)20)23-13-8-9-14-16(11(13)2)19(27)25(3)10-22-14/h6-10,23-24H,5H2,1-4H3 |
| InChIKey | PRXSQVBTGKZELC-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.93 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|