C19H20Cl2N4OS — CID 155747895
6-[2,5-dichloro-3-(propylsulfanylamino)anilino]-3,5-dimethylquinazolin-4-one (PubChem CID 155747895) has the molecular formula C19H20Cl2N4OS and a molecular weight of 423.37 g/mol. Its IUPAC name is 6-[2,5-dichloro-3-(propylsulfanylamino)anilino]-3,5-dimethylquinazolin-4-one.
| Compound Name | 6-[2,5-dichloro-3-(propylsulfanylamino)anilino]-3,5-dimethylquinazolin-4-one |
|---|---|
| PubChem CID | 155747895 |
| Molecular Formula | C19H20Cl2N4OS |
| Molecular Weight | 423.37 g/mol |
| Exact Mass | 422.07 |
| IUPAC Name | 6-[2,5-dichloro-3-(propylsulfanylamino)anilino]-3,5-dimethylquinazolin-4-one |
| SMILES | CCCSNc1cc(Cl)cc(Nc2ccc3ncn(C)c(=O)c3c2C)c1Cl |
| InChI | InChI=1S/C19H20Cl2N4OS/c1-4-7-27-24-16-9-12(20)8-15(18(16)21)23-13-5-6-14-17(11(13)2)19(26)25(3)10-22-14/h5-6,8-10,23-24H,4,7H2,1-3H3 |
| InChIKey | PVJQSPSQFOVHCF-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.37 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|