C22H26ClFN4O2S — CID 155747903
6-[2-chloro-6-fluoro-3-(propylsulfanylamino)anilino]-5-methyl-3H-quinazolin-4-one;oxolane (PubChem CID 155747903) has the molecular formula C22H26ClFN4O2S and a molecular weight of 464.99 g/mol. Its IUPAC name is 6-[2-chloro-6-fluoro-3-(propylsulfanylamino)anilino]-5-methyl-3H-quinazolin-4-one;oxolane.
| Compound Name | 6-[2-chloro-6-fluoro-3-(propylsulfanylamino)anilino]-5-methyl-3H-quinazolin-4-one;oxolane |
|---|---|
| PubChem CID | 155747903 |
| Molecular Formula | C22H26ClFN4O2S |
| Molecular Weight | 464.99 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | 6-[2-chloro-6-fluoro-3-(propylsulfanylamino)anilino]-5-methyl-3H-quinazolin-4-one;oxolane |
| SMILES | C1CCOC1.CCCSNc1ccc(F)c(Nc2ccc3nc[nH]c(=O)c3c2C)c1Cl |
| InChI | InChI=1S/C18H18ClFN4OS.C4H8O/c1-3-8-26-24-14-5-4-11(20)17(16(14)19)23-12-6-7-13-15(10(12)2)18(25)22-9-21-13;1-2-4-5-3-1/h4-7,9,23-24H,3,8H2,1-2H3,(H,21,22,25);1-4H2 |
| InChIKey | RWNPFBTXOGHYMQ-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.99 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|