C19H20F2N4OS — CID 145001185
2,4-difluoro-3-N-(3-methoxy-5-methylquinoxalin-6-yl)-1-N-propylsulfanylbenzene-1,3-diamine (PubChem CID 145001185) has the molecular formula C19H20F2N4OS and a molecular weight of 390.46 g/mol. Its IUPAC name is 2,4-difluoro-3-N-(3-methoxy-5-methylquinoxalin-6-yl)-1-N-propylsulfanylbenzene-1,3-diamine.
| Compound Name | 2,4-difluoro-3-N-(3-methoxy-5-methylquinoxalin-6-yl)-1-N-propylsulfanylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 145001185 |
| Molecular Formula | C19H20F2N4OS |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 2,4-difluoro-3-N-(3-methoxy-5-methylquinoxalin-6-yl)-1-N-propylsulfanylbenzene-1,3-diamine |
| SMILES | CCCSNc1ccc(F)c(Nc2ccc3ncc(OC)nc3c2C)c1F |
| InChI | InChI=1S/C19H20F2N4OS/c1-4-9-27-25-14-6-5-12(20)19(17(14)21)23-13-7-8-15-18(11(13)2)24-16(26-3)10-22-15/h5-8,10,23,25H,4,9H2,1-3H3 |
| InChIKey | DGVRBZUOMARPLB-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|