About ethane;2-methoxy-7,8-dimethylquinoxaline
ethane;2-methoxy-7,8-dimethylquinoxaline (PubChem CID 145260864) has the molecular formula C13H18N2O
and a molecular weight of 218.30 g/mol. Its IUPAC name is ethane;2-methoxy-7,8-dimethylquinoxaline.
Molecular Properties
| Compound Name | ethane;2-methoxy-7,8-dimethylquinoxaline |
| PubChem CID | 145260864 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | ethane;2-methoxy-7,8-dimethylquinoxaline |
| SMILES | CC.COc1cnc2ccc(C)c(C)c2n1 |
| InChI | InChI=1S/C11H12N2O.C2H6/c1-7-4-5-9-11(8(7)2)13-10(14-3)6-12-9;1-2/h4-6H,1-3H3;1-2H3 |
| InChIKey | YEGWXBSJDIPIJG-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;2-methoxy-7,8-dimethylquinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methoxy-7,8-dimethylquinoxaline?
The IUPAC name of ethane;2-methoxy-7,8-dimethylquinoxaline (CID 145260864) is ethane;2-methoxy-7,8-dimethylquinoxaline.
What is the SMILES notation for ethane;2-methoxy-7,8-dimethylquinoxaline?
The canonical SMILES for ethane;2-methoxy-7,8-dimethylquinoxaline is CC.COc1cnc2ccc(C)c(C)c2n1.
What is the InChIKey of ethane;2-methoxy-7,8-dimethylquinoxaline?
The InChIKey is YEGWXBSJDIPIJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O.C2H6/c1-7-4-5-9-11(8(7)2)13-10(14-3)6-12-9;1-2/h4-6H,1-3H3;1-2H3.
What are the key properties of ethane;2-methoxy-7,8-dimethylquinoxaline?
ethane;2-methoxy-7,8-dimethylquinoxaline has a molecular weight of 218.30 g/mol, XLogP of 3.28, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methoxy-7,8-dimethylquinoxaline is sourced from PubChem (CID 145260864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).