C21H24F2N6O4S — CID 166795426
N-[3-[[3-[2-(dimethylamino)ethoxy]-5-nitroquinoxalin-6-yl]amino]-2,4-difluorophenyl]propane-1-sulfinamide (PubChem CID 166795426) has the molecular formula C21H24F2N6O4S and a molecular weight of 494.52 g/mol. Its IUPAC name is N-[3-[[3-[2-(dimethylamino)ethoxy]-5-nitroquinoxalin-6-yl]amino]-2,4-difluorophenyl]propane-1-sulfinamide.
| Compound Name | N-[3-[[3-[2-(dimethylamino)ethoxy]-5-nitroquinoxalin-6-yl]amino]-2,4-difluorophenyl]propane-1-sulfinamide |
|---|---|
| PubChem CID | 166795426 |
| Molecular Formula | C21H24F2N6O4S |
| Molecular Weight | 494.52 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | N-[3-[[3-[2-(dimethylamino)ethoxy]-5-nitroquinoxalin-6-yl]amino]-2,4-difluorophenyl]propane-1-sulfinamide |
| SMILES | CCCS(=O)Nc1ccc(F)c(Nc2ccc3ncc(OCCN(C)C)nc3c2[N+](=O)[O-])c1F |
| InChI | InChI=1S/C21H24F2N6O4S/c1-4-11-34(32)27-14-6-5-13(22)19(18(14)23)25-16-8-7-15-20(21(16)29(30)31)26-17(12-24-15)33-10-9-28(2)3/h5-8,12,25,27H,4,9-11H2,1-3H3 |
| InChIKey | YDSZEXSGVSQLJE-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.52 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|