C20H30N6O2 — CID 126792257
1-[2-[2-(dimethylamino)ethoxy]-4-methylphenyl]-3-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)urea (PubChem CID 126792257) has the molecular formula C20H30N6O2 and a molecular weight of 386.50 g/mol. Its IUPAC name is 1-[2-[2-(dimethylamino)ethoxy]-4-methylphenyl]-3-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)urea.
| Compound Name | 1-[2-[2-(dimethylamino)ethoxy]-4-methylphenyl]-3-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)urea |
|---|---|
| PubChem CID | 126792257 |
| Molecular Formula | C20H30N6O2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | 1-[2-[2-(dimethylamino)ethoxy]-4-methylphenyl]-3-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)urea |
| SMILES | CCc1nc2n(n1)CC(NC(=O)Nc1ccc(C)cc1OCCN(C)C)CC2 |
| InChI | InChI=1S/C20H30N6O2/c1-5-18-23-19-9-7-15(13-26(19)24-18)21-20(27)22-16-8-6-14(2)12-17(16)28-11-10-25(3)4/h6,8,12,15H,5,7,9-11,13H2,1-4H3,(H2,21,22,27) |
| InChIKey | GALATGWCTNYTTR-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |