C18H22N6O — CID 95313954
2-[[[(6R)-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]methyl]-7-methylpyrido[1,2-a]pyrimidin-4-one (PubChem CID 95313954) has the molecular formula C18H22N6O and a molecular weight of 338.42 g/mol. Its IUPAC name is 2-[[[(6R)-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]methyl]-7-methylpyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-[[[(6R)-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]methyl]-7-methylpyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 95313954 |
| Molecular Formula | C18H22N6O |
| Molecular Weight | 338.42 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | 2-[[[(6R)-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]methyl]-7-methylpyrido[1,2-a]pyrimidin-4-one |
| SMILES | CCc1nc2n(n1)C[C@H](NCc1cc(=O)n3cc(C)ccc3n1)CC2 |
| InChI | InChI=1S/C18H22N6O/c1-3-15-21-17-7-5-13(11-24(17)22-15)19-9-14-8-18(25)23-10-12(2)4-6-16(23)20-14/h4,6,8,10,13,19H,3,5,7,9,11H2,1-2H3/t13-/m1/s1 |
| InChIKey | WTUJSGITPXCFQD-CYBMUJFWSA-N |
| XLogP | 1.26 |
| TPSA | 77.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.42 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |