C21H32N4O2 — CID 119127553
N-[(4-butoxy-3-ethoxyphenyl)methyl]-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine (PubChem CID 119127553) has the molecular formula C21H32N4O2 and a molecular weight of 372.51 g/mol. Its IUPAC name is N-[(4-butoxy-3-ethoxyphenyl)methyl]-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine.
| Compound Name | N-[(4-butoxy-3-ethoxyphenyl)methyl]-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
|---|---|
| PubChem CID | 119127553 |
| Molecular Formula | C21H32N4O2 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | N-[(4-butoxy-3-ethoxyphenyl)methyl]-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
| SMILES | CCCCOc1ccc(CNC2CCc3nc(CC)nn3C2)cc1OCC |
| InChI | InChI=1S/C21H32N4O2/c1-4-7-12-27-18-10-8-16(13-19(18)26-6-3)14-22-17-9-11-21-23-20(5-2)24-25(21)15-17/h8,10,13,17,22H,4-7,9,11-12,14-15H2,1-3H3 |
| InChIKey | FXZQEDRZOAVCRI-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 61.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|