C18H22N6O — CID 95329761
(6S)-2-ethyl-N-[[5-(3-methylphenyl)-1,2,4-oxadiazol-3-yl]methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine (PubChem CID 95329761) has the molecular formula C18H22N6O and a molecular weight of 338.42 g/mol. Its IUPAC name is (6S)-2-ethyl-N-[[5-(3-methylphenyl)-1,2,4-oxadiazol-3-yl]methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine.
| Compound Name | (6S)-2-ethyl-N-[[5-(3-methylphenyl)-1,2,4-oxadiazol-3-yl]methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
|---|---|
| PubChem CID | 95329761 |
| Molecular Formula | C18H22N6O |
| Molecular Weight | 338.42 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | (6S)-2-ethyl-N-[[5-(3-methylphenyl)-1,2,4-oxadiazol-3-yl]methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
| SMILES | CCc1nc2n(n1)C[C@@H](NCc1noc(-c3cccc(C)c3)n1)CC2 |
| InChI | InChI=1S/C18H22N6O/c1-3-15-20-17-8-7-14(11-24(17)22-15)19-10-16-21-18(25-23-16)13-6-4-5-12(2)9-13/h4-6,9,14,19H,3,7-8,10-11H2,1-2H3/t14-/m0/s1 |
| InChIKey | COCUKWXHFMWDRO-AWEZNQCLSA-N |
| XLogP | 2.30 |
| TPSA | 81.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.42 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |