C17H21N5O2 — CID 95338695
(6S)-2-ethyl-N-[[2-(furan-2-yl)-5-methyl-1,3-oxazol-4-yl]methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine (PubChem CID 95338695) has the molecular formula C17H21N5O2 and a molecular weight of 327.39 g/mol. Its IUPAC name is (6S)-2-ethyl-N-[[2-(furan-2-yl)-5-methyl-1,3-oxazol-4-yl]methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine.
| Compound Name | (6S)-2-ethyl-N-[[2-(furan-2-yl)-5-methyl-1,3-oxazol-4-yl]methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
|---|---|
| PubChem CID | 95338695 |
| Molecular Formula | C17H21N5O2 |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | (6S)-2-ethyl-N-[[2-(furan-2-yl)-5-methyl-1,3-oxazol-4-yl]methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
| SMILES | CCc1nc2n(n1)C[C@@H](NCc1nc(-c3ccco3)oc1C)CC2 |
| InChI | InChI=1S/C17H21N5O2/c1-3-15-20-16-7-6-12(10-22(16)21-15)18-9-13-11(2)24-17(19-13)14-5-4-8-23-14/h4-5,8,12,18H,3,6-7,9-10H2,1-2H3/t12-/m0/s1 |
| InChIKey | APDHQCIQGPDZQV-LBPRGKRZSA-N |
| XLogP | 2.50 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |