About ethane;iodomethane;3H-quinazolin-4-one
ethane;iodomethane;3H-quinazolin-4-one (PubChem CID 136650915) has the molecular formula C11H15IN2O
and a molecular weight of 318.16 g/mol. Its IUPAC name is ethane;iodomethane;3H-quinazolin-4-one.
Molecular Properties
| Compound Name | ethane;iodomethane;3H-quinazolin-4-one |
| PubChem CID | 136650915 |
| Molecular Formula | C11H15IN2O |
| Molecular Weight | 318.16 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | ethane;iodomethane;3H-quinazolin-4-one |
| SMILES | CC.CI.O=c1[nH]cnc2ccccc12 |
| InChI | InChI=1S/C8H6N2O.C2H6.CH3I/c11-8-6-3-1-2-4-7(6)9-5-10-8;2*1-2/h1-5H,(H,9,10,11);1-2H3;1H3 |
| InChIKey | VOJSDVVGELAJNL-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.16 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze ethane;iodomethane;3H-quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;iodomethane;3H-quinazolin-4-one?
The IUPAC name of ethane;iodomethane;3H-quinazolin-4-one (CID 136650915) is ethane;iodomethane;3H-quinazolin-4-one.
What is the SMILES notation for ethane;iodomethane;3H-quinazolin-4-one?
The canonical SMILES for ethane;iodomethane;3H-quinazolin-4-one is CC.CI.O=c1[nH]cnc2ccccc12.
What is the InChIKey of ethane;iodomethane;3H-quinazolin-4-one?
The InChIKey is VOJSDVVGELAJNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O.C2H6.CH3I/c11-8-6-3-1-2-4-7(6)9-5-10-8;2*1-2/h1-5H,(H,9,10,11);1-2H3;1H3.
What are the key properties of ethane;iodomethane;3H-quinazolin-4-one?
ethane;iodomethane;3H-quinazolin-4-one has a molecular weight of 318.16 g/mol, XLogP of 3.00, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;iodomethane;3H-quinazolin-4-one is sourced from PubChem (CID 136650915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).