C20H18N4 — CID 155364533
4-(3,3-dimethylazetidin-1-yl)-6-(3-ethynylphenyl)pyrido[3,2-d]pyrimidine (PubChem CID 155364533) has the molecular formula C20H18N4 and a molecular weight of 314.39 g/mol. Its IUPAC name is 4-(3,3-dimethylazetidin-1-yl)-6-(3-ethynylphenyl)pyrido[3,2-d]pyrimidine.
| Compound Name | 4-(3,3-dimethylazetidin-1-yl)-6-(3-ethynylphenyl)pyrido[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 155364533 |
| Molecular Formula | C20H18N4 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 4-(3,3-dimethylazetidin-1-yl)-6-(3-ethynylphenyl)pyrido[3,2-d]pyrimidine |
| SMILES | C#Cc1cccc(-c2ccc3ncnc(N4CC(C)(C)C4)c3n2)c1 |
| InChI | InChI=1S/C20H18N4/c1-4-14-6-5-7-15(10-14)16-8-9-17-18(23-16)19(22-13-21-17)24-11-20(2,3)12-24/h1,5-10,13H,11-12H2,2-3H3 |
| InChIKey | IWMYQCFEZUZRJQ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|