C20H15N5O — CID 155364532
4-[2-[3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)phenyl]ethynyl]-1-methyl-2H-pyrrol-5-one (PubChem CID 155364532) has the molecular formula C20H15N5O and a molecular weight of 341.37 g/mol. Its IUPAC name is 4-[2-[3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)phenyl]ethynyl]-1-methyl-2H-pyrrol-5-one.
| Compound Name | 4-[2-[3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)phenyl]ethynyl]-1-methyl-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 155364532 |
| Molecular Formula | C20H15N5O |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 4-[2-[3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)phenyl]ethynyl]-1-methyl-2H-pyrrol-5-one |
| SMILES | CN1CC=C(C#Cc2cccc(-c3ccc4ncnc(N)c4n3)c2)C1=O |
| InChI | InChI=1S/C20H15N5O/c1-25-10-9-14(20(25)26)6-5-13-3-2-4-15(11-13)16-7-8-17-18(24-16)19(21)23-12-22-17/h2-4,7-9,11-12H,10H2,1H3,(H2,21,22,23) |
| InChIKey | OUMQYRXEHPAIFB-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 85.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|