C21H19N5O2 — CID 171990582
(3S)-3-[2-[3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)phenyl]ethynyl]-3-hydroxy-1-methylpiperidin-2-one (PubChem CID 171990582) has the molecular formula C21H19N5O2 and a molecular weight of 373.42 g/mol. Its IUPAC name is (3S)-3-[2-[3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)phenyl]ethynyl]-3-hydroxy-1-methylpiperidin-2-one.
| Compound Name | (3S)-3-[2-[3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)phenyl]ethynyl]-3-hydroxy-1-methylpiperidin-2-one |
|---|---|
| PubChem CID | 171990582 |
| Molecular Formula | C21H19N5O2 |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | (3S)-3-[2-[3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)phenyl]ethynyl]-3-hydroxy-1-methylpiperidin-2-one |
| SMILES | CN1CCC[C@](O)(C#Cc2cccc(-c3ccc4ncnc(N)c4n3)c2)C1=O |
| InChI | InChI=1S/C21H19N5O2/c1-26-11-3-9-21(28,20(26)27)10-8-14-4-2-5-15(12-14)16-6-7-17-18(25-16)19(22)24-13-23-17/h2,4-7,12-13,28H,3,9,11H2,1H3,(H2,22,23,24)/t21-/m0/s1 |
| InChIKey | OYCLKJFNFRJGOD-NRFANRHFSA-N |
| XLogP | 1.61 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|