C21H17F2N5O — CID 155341199
(3R)-3-[2-[3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)phenyl]ethynyl]-3-(difluoromethyl)-1-methylpyrrolidin-2-one (PubChem CID 155341199) has the molecular formula C21H17F2N5O and a molecular weight of 393.40 g/mol. Its IUPAC name is (3R)-3-[2-[3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)phenyl]ethynyl]-3-(difluoromethyl)-1-methylpyrrolidin-2-one.
| Compound Name | (3R)-3-[2-[3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)phenyl]ethynyl]-3-(difluoromethyl)-1-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 155341199 |
| Molecular Formula | C21H17F2N5O |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | (3R)-3-[2-[3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)phenyl]ethynyl]-3-(difluoromethyl)-1-methylpyrrolidin-2-one |
| SMILES | CN1CC[C@](C#Cc2cccc(-c3ccc4ncnc(N)c4n3)c2)(C(F)F)C1=O |
| InChI | InChI=1S/C21H17F2N5O/c1-28-10-9-21(19(22)23,20(28)29)8-7-13-3-2-4-14(11-13)15-5-6-16-17(27-15)18(24)26-12-25-16/h2-6,11-12,19H,9-10H2,1H3,(H2,24,25,26)/t21-/m1/s1 |
| InChIKey | QNTCSJZXOSFONX-OAQYLSRUSA-N |
| XLogP | 2.74 |
| TPSA | 85.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|