C22H20N4O2 — CID 155340705
(2S)-2-[2-[3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)phenyl]ethynyl]-2-hydroxy-5,5-dimethylcyclopentan-1-one (PubChem CID 155340705) has the molecular formula C22H20N4O2 and a molecular weight of 372.43 g/mol. Its IUPAC name is (2S)-2-[2-[3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)phenyl]ethynyl]-2-hydroxy-5,5-dimethylcyclopentan-1-one.
| Compound Name | (2S)-2-[2-[3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)phenyl]ethynyl]-2-hydroxy-5,5-dimethylcyclopentan-1-one |
|---|---|
| PubChem CID | 155340705 |
| Molecular Formula | C22H20N4O2 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | (2S)-2-[2-[3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)phenyl]ethynyl]-2-hydroxy-5,5-dimethylcyclopentan-1-one |
| SMILES | CC1(C)CC[C@](O)(C#Cc2cccc(-c3ccc4ncnc(N)c4n3)c2)C1=O |
| InChI | InChI=1S/C22H20N4O2/c1-21(2)10-11-22(28,20(21)27)9-8-14-4-3-5-15(12-14)16-6-7-17-18(26-16)19(23)25-13-24-17/h3-7,12-13,28H,10-11H2,1-2H3,(H2,23,24,25)/t22-/m1/s1 |
| InChIKey | HEUQITPZQHFSQM-JOCHJYFZSA-N |
| XLogP | 2.75 |
| TPSA | 101.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|