C23H19N5 — CID 155363993
2-methyl-6-[3-[(3S)-3-pyridin-2-ylbut-1-ynyl]phenyl]pyrido[3,2-d]pyrimidin-4-amine (PubChem CID 155363993) has the molecular formula C23H19N5 and a molecular weight of 365.44 g/mol. Its IUPAC name is 2-methyl-6-[3-[(3S)-3-pyridin-2-ylbut-1-ynyl]phenyl]pyrido[3,2-d]pyrimidin-4-amine.
| Compound Name | 2-methyl-6-[3-[(3S)-3-pyridin-2-ylbut-1-ynyl]phenyl]pyrido[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 155363993 |
| Molecular Formula | C23H19N5 |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 2-methyl-6-[3-[(3S)-3-pyridin-2-ylbut-1-ynyl]phenyl]pyrido[3,2-d]pyrimidin-4-amine |
| SMILES | Cc1nc(N)c2nc(-c3cccc(C#C[C@H](C)c4ccccn4)c3)ccc2n1 |
| InChI | InChI=1S/C23H19N5/c1-15(19-8-3-4-13-25-19)9-10-17-6-5-7-18(14-17)20-11-12-21-22(28-20)23(24)27-16(2)26-21/h3-8,11-15H,1-2H3,(H2,24,26,27)/t15-/m0/s1 |
| InChIKey | IRFRKPWLYPAKNS-HNNXBMFYSA-N |
| XLogP | 4.13 |
| TPSA | 77.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|