C15H10N4O — CID 163213176
4-amino-6-(3-ethynylphenyl)-1H-pyrido[3,2-d]pyrimidin-2-one (PubChem CID 163213176) has the molecular formula C15H10N4O and a molecular weight of 262.27 g/mol. Its IUPAC name is 4-amino-6-(3-ethynylphenyl)-1H-pyrido[3,2-d]pyrimidin-2-one.
| Compound Name | 4-amino-6-(3-ethynylphenyl)-1H-pyrido[3,2-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 163213176 |
| Molecular Formula | C15H10N4O |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 4-amino-6-(3-ethynylphenyl)-1H-pyrido[3,2-d]pyrimidin-2-one |
| SMILES | C#Cc1cccc(-c2ccc3[nH]c(=O)nc(N)c3n2)c1 |
| InChI | InChI=1S/C15H10N4O/c1-2-9-4-3-5-10(8-9)11-6-7-12-13(17-11)14(16)19-15(20)18-12/h1,3-8H,(H3,16,18,19,20) |
| InChIKey | LRRDRVWQPKASQK-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|