C15H12N2O — CID 144793661
6-(3-ethynylphenyl)-4-methylpyridine-2-carboxamide (PubChem CID 144793661) has the molecular formula C15H12N2O and a molecular weight of 236.27 g/mol. Its IUPAC name is 6-(3-ethynylphenyl)-4-methylpyridine-2-carboxamide.
| Compound Name | 6-(3-ethynylphenyl)-4-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 144793661 |
| Molecular Formula | C15H12N2O |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | 6-(3-ethynylphenyl)-4-methylpyridine-2-carboxamide |
| SMILES | C#Cc1cccc(-c2cc(C)cc(C(N)=O)n2)c1 |
| InChI | InChI=1S/C15H12N2O/c1-3-11-5-4-6-12(9-11)13-7-10(2)8-14(17-13)15(16)18/h1,4-9H,2H3,(H2,16,18) |
| InChIKey | SJXYJTJTEXRLJV-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|