2-(3-ethynylphenyl)benzene-1,3-dicarboxylic acid

C16H10O4 — CID 150178179

IUPAC2-(3-ethynylphenyl)benzene-1,3-dicarboxylic acid
SMILESC#Cc1cccc(-c2c(C(=O)O)cccc2C(=O)O)c1
InChIInChI=1S/C16H10O4/c1-2-10-5-3-6-11(9-10)14-12(15(17)18)7-4-8-13(14)16(19)20/h1,3-9H,(H,17,18)(H,19,20)
InChIKeyFKVSHWHHNSSNOF-UHFFFAOYSA-N
MW266.25 g/mol
LogP2.73
Rot. Bonds3

About 2-(3-ethynylphenyl)benzene-1,3-dicarboxylic acid

2-(3-ethynylphenyl)benzene-1,3-dicarboxylic acid (PubChem CID 150178179) has the molecular formula C16H10O4 and a molecular weight of 266.25 g/mol. Its IUPAC name is 2-(3-ethynylphenyl)benzene-1,3-dicarboxylic acid.

Molecular Properties

Compound Name2-(3-ethynylphenyl)benzene-1,3-dicarboxylic acid
PubChem CID150178179
Molecular FormulaC16H10O4
Molecular Weight266.25 g/mol
Exact Mass266.06
IUPAC Name2-(3-ethynylphenyl)benzene-1,3-dicarboxylic acid
SMILESC#Cc1cccc(-c2c(C(=O)O)cccc2C(=O)O)c1
InChIInChI=1S/C16H10O4/c1-2-10-5-3-6-11(9-10)14-12(15(17)18)7-4-8-13(14)16(19)20/h1,3-9H,(H,17,18)(H,19,20)
InChIKeyFKVSHWHHNSSNOF-UHFFFAOYSA-N
XLogP2.73
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500266.25
LogP ≤ 52.73
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'triple_bond', 'substructure': 'N/A'}

Analyze 2-(3-ethynylphenyl)benzene-1,3-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3-ethynylphenyl)benzene-1,3-dicarboxylic acid?
The IUPAC name of 2-(3-ethynylphenyl)benzene-1,3-dicarboxylic acid (CID 150178179) is 2-(3-ethynylphenyl)benzene-1,3-dicarboxylic acid.
What is the SMILES notation for 2-(3-ethynylphenyl)benzene-1,3-dicarboxylic acid?
The canonical SMILES for 2-(3-ethynylphenyl)benzene-1,3-dicarboxylic acid is C#Cc1cccc(-c2c(C(=O)O)cccc2C(=O)O)c1.
What is the InChIKey of 2-(3-ethynylphenyl)benzene-1,3-dicarboxylic acid?
The InChIKey is FKVSHWHHNSSNOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10O4/c1-2-10-5-3-6-11(9-10)14-12(15(17)18)7-4-8-13(14)16(19)20/h1,3-9H,(H,17,18)(H,19,20).
What are the key properties of 2-(3-ethynylphenyl)benzene-1,3-dicarboxylic acid?
2-(3-ethynylphenyl)benzene-1,3-dicarboxylic acid has a molecular weight of 266.25 g/mol, XLogP of 2.73, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-ethynylphenyl)benzene-1,3-dicarboxylic acid is sourced from PubChem (CID 150178179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).