C22H13NO2S — CID 122688539
2-(1,3-benzothiazol-6-yl)-3-ethynylbenzoic acid;bicyclo[3.1.0]hexa-1(6),2,4-triene (PubChem CID 122688539) has the molecular formula C22H13NO2S and a molecular weight of 355.42 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-6-yl)-3-ethynylbenzoic acid;bicyclo[3.1.0]hexa-1(6),2,4-triene.
| Compound Name | 2-(1,3-benzothiazol-6-yl)-3-ethynylbenzoic acid;bicyclo[3.1.0]hexa-1(6),2,4-triene |
|---|---|
| PubChem CID | 122688539 |
| Molecular Formula | C22H13NO2S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | 2-(1,3-benzothiazol-6-yl)-3-ethynylbenzoic acid;bicyclo[3.1.0]hexa-1(6),2,4-triene |
| SMILES | C#Cc1cccc(C(=O)O)c1-c1ccc2ncsc2c1.c1cc2cc-2c1 |
| InChI | InChI=1S/C16H9NO2S.C6H4/c1-2-10-4-3-5-12(16(18)19)15(10)11-6-7-13-14(8-11)20-9-17-13;1-2-5-4-6(5)3-1/h1,3-9H,(H,18,19);1-4H |
| InChIKey | ZBNPCUSTFHFTQL-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|