2-(1,3-benzothiazol-6-yl)pyrimidine-4-carboxylic acid

C12H7N3O2S — CID 68517724

IUPAC2-(1,3-benzothiazol-6-yl)pyrimidine-4-carboxylic acid
SMILESO=C(O)c1ccnc(-c2ccc3ncsc3c2)n1
InChIInChI=1S/C12H7N3O2S/c16-12(17)9-3-4-13-11(15-9)7-1-2-8-10(5-7)18-6-14-8/h1-6H,(H,16,17)
InChIKeyLURSVUPGIIIMSE-UHFFFAOYSA-N
MW257.27 g/mol
LogP2.45
Rot. Bonds2

About 2-(1,3-benzothiazol-6-yl)pyrimidine-4-carboxylic acid

2-(1,3-benzothiazol-6-yl)pyrimidine-4-carboxylic acid (PubChem CID 68517724) has the molecular formula C12H7N3O2S and a molecular weight of 257.27 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-6-yl)pyrimidine-4-carboxylic acid.

Molecular Properties

Compound Name2-(1,3-benzothiazol-6-yl)pyrimidine-4-carboxylic acid
PubChem CID68517724
Molecular FormulaC12H7N3O2S
Molecular Weight257.27 g/mol
Exact Mass257.03
IUPAC Name2-(1,3-benzothiazol-6-yl)pyrimidine-4-carboxylic acid
SMILESO=C(O)c1ccnc(-c2ccc3ncsc3c2)n1
InChIInChI=1S/C12H7N3O2S/c16-12(17)9-3-4-13-11(15-9)7-1-2-8-10(5-7)18-6-14-8/h1-6H,(H,16,17)
InChIKeyLURSVUPGIIIMSE-UHFFFAOYSA-N
XLogP2.45
TPSA75.97 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500257.27
LogP ≤ 52.45
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-(1,3-benzothiazol-6-yl)pyrimidine-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,3-benzothiazol-6-yl)pyrimidine-4-carboxylic acid?
The IUPAC name of 2-(1,3-benzothiazol-6-yl)pyrimidine-4-carboxylic acid (CID 68517724) is 2-(1,3-benzothiazol-6-yl)pyrimidine-4-carboxylic acid.
What is the SMILES notation for 2-(1,3-benzothiazol-6-yl)pyrimidine-4-carboxylic acid?
The canonical SMILES for 2-(1,3-benzothiazol-6-yl)pyrimidine-4-carboxylic acid is O=C(O)c1ccnc(-c2ccc3ncsc3c2)n1.
What is the InChIKey of 2-(1,3-benzothiazol-6-yl)pyrimidine-4-carboxylic acid?
The InChIKey is LURSVUPGIIIMSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7N3O2S/c16-12(17)9-3-4-13-11(15-9)7-1-2-8-10(5-7)18-6-14-8/h1-6H,(H,16,17).
What are the key properties of 2-(1,3-benzothiazol-6-yl)pyrimidine-4-carboxylic acid?
2-(1,3-benzothiazol-6-yl)pyrimidine-4-carboxylic acid has a molecular weight of 257.27 g/mol, XLogP of 2.45, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-benzothiazol-6-yl)pyrimidine-4-carboxylic acid is sourced from PubChem (CID 68517724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).