2-[(1,3-benzothiazol-6-ylamino)methyl]benzoic acid

C15H12N2O2S — CID 107805893

IUPAC2-[(1,3-benzothiazol-6-ylamino)methyl]benzoic acid
SMILESO=C(O)c1ccccc1CNc1ccc2ncsc2c1
InChIInChI=1S/C15H12N2O2S/c18-15(19)12-4-2-1-3-10(12)8-16-11-5-6-13-14(7-11)20-9-17-13/h1-7,9,16H,8H2,(H,18,19)
InChIKeyRXOXVCVRYWTNER-UHFFFAOYSA-N
MW284.34 g/mol
LogP3.61
Rot. Bonds4

About 2-[(1,3-benzothiazol-6-ylamino)methyl]benzoic acid

2-[(1,3-benzothiazol-6-ylamino)methyl]benzoic acid (PubChem CID 107805893) has the molecular formula C15H12N2O2S and a molecular weight of 284.34 g/mol. Its IUPAC name is 2-[(1,3-benzothiazol-6-ylamino)methyl]benzoic acid.

Molecular Properties

Compound Name2-[(1,3-benzothiazol-6-ylamino)methyl]benzoic acid
PubChem CID107805893
Molecular FormulaC15H12N2O2S
Molecular Weight284.34 g/mol
Exact Mass284.06
IUPAC Name2-[(1,3-benzothiazol-6-ylamino)methyl]benzoic acid
SMILESO=C(O)c1ccccc1CNc1ccc2ncsc2c1
InChIInChI=1S/C15H12N2O2S/c18-15(19)12-4-2-1-3-10(12)8-16-11-5-6-13-14(7-11)20-9-17-13/h1-7,9,16H,8H2,(H,18,19)
InChIKeyRXOXVCVRYWTNER-UHFFFAOYSA-N
XLogP3.61
TPSA62.22 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500284.34
LogP ≤ 53.61
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-[(1,3-benzothiazol-6-ylamino)methyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(1,3-benzothiazol-6-ylamino)methyl]benzoic acid?
The IUPAC name of 2-[(1,3-benzothiazol-6-ylamino)methyl]benzoic acid (CID 107805893) is 2-[(1,3-benzothiazol-6-ylamino)methyl]benzoic acid.
What is the SMILES notation for 2-[(1,3-benzothiazol-6-ylamino)methyl]benzoic acid?
The canonical SMILES for 2-[(1,3-benzothiazol-6-ylamino)methyl]benzoic acid is O=C(O)c1ccccc1CNc1ccc2ncsc2c1.
What is the InChIKey of 2-[(1,3-benzothiazol-6-ylamino)methyl]benzoic acid?
The InChIKey is RXOXVCVRYWTNER-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N2O2S/c18-15(19)12-4-2-1-3-10(12)8-16-11-5-6-13-14(7-11)20-9-17-13/h1-7,9,16H,8H2,(H,18,19).
What are the key properties of 2-[(1,3-benzothiazol-6-ylamino)methyl]benzoic acid?
2-[(1,3-benzothiazol-6-ylamino)methyl]benzoic acid has a molecular weight of 284.34 g/mol, XLogP of 3.61, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1,3-benzothiazol-6-ylamino)methyl]benzoic acid is sourced from PubChem (CID 107805893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).