C18H12N2O4S3 — CID 166332946
2-[[5-(1,3-benzothiazol-6-yl)thiophen-2-yl]sulfonylamino]benzoic acid (PubChem CID 166332946) has the molecular formula C18H12N2O4S3 and a molecular weight of 416.51 g/mol. Its IUPAC name is 2-[[5-(1,3-benzothiazol-6-yl)thiophen-2-yl]sulfonylamino]benzoic acid.
| Compound Name | 2-[[5-(1,3-benzothiazol-6-yl)thiophen-2-yl]sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 166332946 |
| Molecular Formula | C18H12N2O4S3 |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.00 |
| IUPAC Name | 2-[[5-(1,3-benzothiazol-6-yl)thiophen-2-yl]sulfonylamino]benzoic acid |
| SMILES | O=C(O)c1ccccc1NS(=O)(=O)c1ccc(-c2ccc3ncsc3c2)s1 |
| InChI | InChI=1S/C18H12N2O4S3/c21-18(22)12-3-1-2-4-13(12)20-27(23,24)17-8-7-15(26-17)11-5-6-14-16(9-11)25-10-19-14/h1-10,20H,(H,21,22) |
| InChIKey | CXSHKIJGMKLCRN-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |