C20H13ClN2O4S2 — CID 10095019
N-(2-benzoyl-4-chlorophenyl)-5-(1,2-oxazol-3-yl)thiophene-2-sulfonamide (PubChem CID 10095019) has the molecular formula C20H13ClN2O4S2 and a molecular weight of 444.92 g/mol. Its IUPAC name is N-(2-benzoyl-4-chlorophenyl)-5-(1,2-oxazol-3-yl)thiophene-2-sulfonamide.
| Compound Name | N-(2-benzoyl-4-chlorophenyl)-5-(1,2-oxazol-3-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 10095019 |
| Molecular Formula | C20H13ClN2O4S2 |
| Molecular Weight | 444.92 g/mol |
| Exact Mass | 444.00 |
| IUPAC Name | N-(2-benzoyl-4-chlorophenyl)-5-(1,2-oxazol-3-yl)thiophene-2-sulfonamide |
| SMILES | O=C(c1ccccc1)c1cc(Cl)ccc1NS(=O)(=O)c1ccc(-c2ccon2)s1 |
| InChI | InChI=1S/C20H13ClN2O4S2/c21-14-6-7-16(15(12-14)20(24)13-4-2-1-3-5-13)23-29(25,26)19-9-8-18(28-19)17-10-11-27-22-17/h1-12,23H |
| InChIKey | VHFLKMYYXILNQO-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.92 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|