C13H10N2O2 — CID 145143182
2-(3-ethynylphenyl)-5-methyl-1,3-oxazole-4-carboxamide (PubChem CID 145143182) has the molecular formula C13H10N2O2 and a molecular weight of 226.23 g/mol. Its IUPAC name is 2-(3-ethynylphenyl)-5-methyl-1,3-oxazole-4-carboxamide.
| Compound Name | 2-(3-ethynylphenyl)-5-methyl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 145143182 |
| Molecular Formula | C13H10N2O2 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | 2-(3-ethynylphenyl)-5-methyl-1,3-oxazole-4-carboxamide |
| SMILES | C#Cc1cccc(-c2nc(C(N)=O)c(C)o2)c1 |
| InChI | InChI=1S/C13H10N2O2/c1-3-9-5-4-6-10(7-9)13-15-11(12(14)16)8(2)17-13/h1,4-7H,2H3,(H2,14,16) |
| InChIKey | LAXHCJXKARGJOC-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|