C17H9NO — CID 146926501
5-ethynyl-2-(3-ethynylphenyl)-1,3-benzoxazole (PubChem CID 146926501) has the molecular formula C17H9NO and a molecular weight of 243.26 g/mol. Its IUPAC name is 5-ethynyl-2-(3-ethynylphenyl)-1,3-benzoxazole.
| Compound Name | 5-ethynyl-2-(3-ethynylphenyl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 146926501 |
| Molecular Formula | C17H9NO |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 5-ethynyl-2-(3-ethynylphenyl)-1,3-benzoxazole |
| SMILES | C#Cc1cccc(-c2nc3cc(C#C)ccc3o2)c1 |
| InChI | InChI=1S/C17H9NO/c1-3-12-6-5-7-14(10-12)17-18-15-11-13(4-2)8-9-16(15)19-17/h1-2,5-11H |
| InChIKey | AEEHWIKOYCRHLI-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|