C16H20N2O2 — CID 122175374
N-butyl-5-methyl-2-(3-methylphenyl)-1,3-oxazole-4-carboxamide (PubChem CID 122175374) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is N-butyl-5-methyl-2-(3-methylphenyl)-1,3-oxazole-4-carboxamide.
| Compound Name | N-butyl-5-methyl-2-(3-methylphenyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 122175374 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | N-butyl-5-methyl-2-(3-methylphenyl)-1,3-oxazole-4-carboxamide |
| SMILES | CCCCNC(=O)c1nc(-c2cccc(C)c2)oc1C |
| InChI | InChI=1S/C16H20N2O2/c1-4-5-9-17-15(19)14-12(3)20-16(18-14)13-8-6-7-11(2)10-13/h6-8,10H,4-5,9H2,1-3H3,(H,17,19) |
| InChIKey | DDGSTSLKYWGSIR-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|